C20H26N4O10 — CID 11038187
diethyl (2R,3R)-2,3-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]butanedioate (PubChem CID 11038187) has the molecular formula C20H26N4O10 and a molecular weight of 482.45 g/mol. Its IUPAC name is diethyl (2R,3R)-2,3-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]butanedioate.
| Compound Name | diethyl (2R,3R)-2,3-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]butanedioate |
|---|---|
| PubChem CID | 11038187 |
| Molecular Formula | C20H26N4O10 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | diethyl (2R,3R)-2,3-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]butanedioate |
| SMILES | CCOC(=O)[C@H](Oc1nc(OC)cc(OC)n1)[C@@H](Oc1nc(OC)cc(OC)n1)C(=O)OCC |
| InChI | InChI=1S/C20H26N4O10/c1-7-31-17(25)15(33-19-21-11(27-3)9-12(22-19)28-4)16(18(26)32-8-2)34-20-23-13(29-5)10-14(24-20)30-6/h9-10,15-16H,7-8H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | GSMPXNGRLWZBMK-HZPDHXFCSA-N |
| XLogP | 0.62 |
| TPSA | 159.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |