About tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate
tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate (PubChem CID 4096292) has the molecular formula C18H29N3O6
and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate |
| PubChem CID | 4096292 |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate |
| SMILES | COc1cc(OC)nc(OC(C(=O)NC(C)C(=O)OC(C)(C)C)C(C)C)n1 |
| InChI | InChI=1S/C18H29N3O6/c1-10(2)14(15(22)19-11(3)16(23)27-18(4,5)6)26-17-20-12(24-7)9-13(21-17)25-8/h9-11,14H,1-8H3,(H,19,22) |
| InChIKey | KOPUFLHMAFFKQJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate?
The IUPAC name of tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate (CID 4096292) is tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate.
What is the SMILES notation for tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate?
The canonical SMILES for tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate is COc1cc(OC)nc(OC(C(=O)NC(C)C(=O)OC(C)(C)C)C(C)C)n1.
What is the InChIKey of tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate?
The InChIKey is KOPUFLHMAFFKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O6/c1-10(2)14(15(22)19-11(3)16(23)27-18(4,5)6)26-17-20-12(24-7)9-13(21-17)25-8/h9-11,14H,1-8H3,(H,19,22).
What are the key properties of tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate?
tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate has a molecular weight of 383.45 g/mol, XLogP of 1.74, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methylbutanoyl]amino]propanoate is sourced from PubChem (CID 4096292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).