C11H21NO3 — CID 76825480
tert-butyl 2-(2-methylpropanoylamino)propanoate (PubChem CID 76825480) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl 2-(2-methylpropanoylamino)propanoate.
| Compound Name | tert-butyl 2-(2-methylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 76825480 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl 2-(2-methylpropanoylamino)propanoate |
| SMILES | CC(C)C(=O)NC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-7(2)9(13)12-8(3)10(14)15-11(4,5)6/h7-8H,1-6H3,(H,12,13) |
| InChIKey | OLUCEDQINWGPKT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |