C13H25N3O4 — CID 14487194
tert-butyl 2-[2-(2-aminopropanoylamino)propanoylamino]propanoate (PubChem CID 14487194) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-aminopropanoylamino)propanoylamino]propanoate.
| Compound Name | tert-butyl 2-[2-(2-aminopropanoylamino)propanoylamino]propanoate |
|---|---|
| PubChem CID | 14487194 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | tert-butyl 2-[2-(2-aminopropanoylamino)propanoylamino]propanoate |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-7(14)10(17)15-8(2)11(18)16-9(3)12(19)20-13(4,5)6/h7-9H,14H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | HMLAOYTZSFORCJ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |