C12H22N2O5 — CID 87732284
tert-butyl (2S)-2-[[(2S)-2-[(2-hydroxyacetyl)amino]propanoyl]amino]propanoate (PubChem CID 87732284) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[(2-hydroxyacetyl)amino]propanoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[(2-hydroxyacetyl)amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 87732284 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[(2-hydroxyacetyl)amino]propanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)CO)C(=O)N[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O5/c1-7(13-9(16)6-15)10(17)14-8(2)11(18)19-12(3,4)5/h7-8,15H,6H2,1-5H3,(H,13,16)(H,14,17)/t7-,8-/m0/s1 |
| InChIKey | SEKFSQRXYZUOPZ-YUMQZZPRSA-N |
| XLogP | -0.67 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |