C16H28N2O5 — CID 130342884
tert-butyl (2S)-2-[[(2S)-2-(6-oxohexanoylamino)propanoyl]amino]propanoate (PubChem CID 130342884) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-(6-oxohexanoylamino)propanoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-(6-oxohexanoylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 130342884 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-(6-oxohexanoylamino)propanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)CCCCC=O)C(=O)N[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O5/c1-11(17-13(20)9-7-6-8-10-19)14(21)18-12(2)15(22)23-16(3,4)5/h10-12H,6-9H2,1-5H3,(H,17,20)(H,18,21)/t11-,12-/m0/s1 |
| InChIKey | XHNWGSFWEFQTEU-RYUDHWBXSA-N |
| XLogP | 1.10 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|