C14H23NO3 — CID 113349823
tert-butyl (2S)-2-(hept-6-ynoylamino)propanoate (PubChem CID 113349823) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl (2S)-2-(hept-6-ynoylamino)propanoate.
| Compound Name | tert-butyl (2S)-2-(hept-6-ynoylamino)propanoate |
|---|---|
| PubChem CID | 113349823 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl (2S)-2-(hept-6-ynoylamino)propanoate |
| SMILES | C#CCCCCC(=O)N[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO3/c1-6-7-8-9-10-12(16)15-11(2)13(17)18-14(3,4)5/h1,11H,7-10H2,2-5H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | SKZGLSOTUROBLG-NSHDSACASA-N |
| XLogP | 2.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|