C18H31NO6 — CID 157455298
tert-butyl (2S,5S)-5-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-4-oxohexanoate (PubChem CID 157455298) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl (2S,5S)-5-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-4-oxohexanoate.
| Compound Name | tert-butyl (2S,5S)-5-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-4-oxohexanoate |
|---|---|
| PubChem CID | 157455298 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | tert-butyl (2S,5S)-5-[(6-methoxy-6-oxohexanoyl)amino]-2-methyl-4-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N[C@@H](C)C(=O)C[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO6/c1-12(17(23)25-18(3,4)5)11-14(20)13(2)19-15(21)9-7-8-10-16(22)24-6/h12-13H,7-11H2,1-6H3,(H,19,21)/t12-,13-/m0/s1 |
| InChIKey | MCMHWPDEIHDPHH-STQMWFEESA-N |
| XLogP | 2.16 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|