C22H31ClN2O6 — CID 158182511
methyl 6-[[(2S,5R)-6-[3-(chloromethyl)-5-(hydroxymethyl)anilino]-5-methyl-3,6-dioxohexan-2-yl]amino]-6-oxohexanoate (PubChem CID 158182511) has the molecular formula C22H31ClN2O6 and a molecular weight of 454.95 g/mol. Its IUPAC name is methyl 6-[[(2S,5R)-6-[3-(chloromethyl)-5-(hydroxymethyl)anilino]-5-methyl-3,6-dioxohexan-2-yl]amino]-6-oxohexanoate.
| Compound Name | methyl 6-[[(2S,5R)-6-[3-(chloromethyl)-5-(hydroxymethyl)anilino]-5-methyl-3,6-dioxohexan-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 158182511 |
| Molecular Formula | C22H31ClN2O6 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl 6-[[(2S,5R)-6-[3-(chloromethyl)-5-(hydroxymethyl)anilino]-5-methyl-3,6-dioxohexan-2-yl]amino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N[C@@H](C)C(=O)C[C@@H](C)C(=O)Nc1cc(CO)cc(CCl)c1 |
| InChI | InChI=1S/C22H31ClN2O6/c1-14(22(30)25-18-10-16(12-23)9-17(11-18)13-26)8-19(27)15(2)24-20(28)6-4-5-7-21(29)31-3/h9-11,14-15,26H,4-8,12-13H2,1-3H3,(H,24,28)(H,25,30)/t14-,15+/m1/s1 |
| InChIKey | UWONWOJDLOPQCZ-CABCVRRESA-N |
| XLogP | 2.69 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|