C22H31N3O6 — CID 146653390
methyl 6-[[(2S)-1-[[(2R)-1-[3-hydroxy-5-(hydroxymethyl)anilino]but-3-en-2-yl]amino]-1-oxobut-3-en-2-yl]amino]-6-oxohexanoate (PubChem CID 146653390) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-[[(2R)-1-[3-hydroxy-5-(hydroxymethyl)anilino]but-3-en-2-yl]amino]-1-oxobut-3-en-2-yl]amino]-6-oxohexanoate.
| Compound Name | methyl 6-[[(2S)-1-[[(2R)-1-[3-hydroxy-5-(hydroxymethyl)anilino]but-3-en-2-yl]amino]-1-oxobut-3-en-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 146653390 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | methyl 6-[[(2S)-1-[[(2R)-1-[3-hydroxy-5-(hydroxymethyl)anilino]but-3-en-2-yl]amino]-1-oxobut-3-en-2-yl]amino]-6-oxohexanoate |
| SMILES | C=C[C@H](CNc1cc(O)cc(CO)c1)NC(=O)[C@H](C=C)NC(=O)CCCCC(=O)OC |
| InChI | InChI=1S/C22H31N3O6/c1-4-16(13-23-17-10-15(14-26)11-18(27)12-17)24-22(30)19(5-2)25-20(28)8-6-7-9-21(29)31-3/h4-5,10-12,16,19,23,26-27H,1-2,6-9,13-14H2,3H3,(H,24,30)(H,25,28)/t16-,19+/m1/s1 |
| InChIKey | GQHRNZJTCGCVMN-APWZRJJASA-N |
| XLogP | 1.37 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|