C21H30N2O5 — CID 56836251
methyl 6-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-6-oxohexanoate (PubChem CID 56836251) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl 6-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-6-oxohexanoate.
| Compound Name | methyl 6-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 56836251 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | methyl 6-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N[C@H](C(=O)NC(C=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H30N2O5/c1-15(2)20(23-18(25)11-7-8-12-19(26)28-3)21(27)22-17(14-24)13-16-9-5-4-6-10-16/h4-6,9-10,14-15,17,20H,7-8,11-13H2,1-3H3,(H,22,27)(H,23,25)/t17?,20-/m0/s1 |
| InChIKey | OLWNHFDDUIXKCW-OZBJMMHXSA-N |
| XLogP | 1.79 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|