C22H31N3O6 — CID 56836775
methyl 6-[[(2S)-1-[(4-amino-3,4-dioxo-1-phenylbutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate (PubChem CID 56836775) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-[(4-amino-3,4-dioxo-1-phenylbutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate.
| Compound Name | methyl 6-[[(2S)-1-[(4-amino-3,4-dioxo-1-phenylbutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 56836775 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | methyl 6-[[(2S)-1-[(4-amino-3,4-dioxo-1-phenylbutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N[C@H](C(=O)NC(Cc1ccccc1)C(=O)C(N)=O)C(C)C |
| InChI | InChI=1S/C22H31N3O6/c1-14(2)19(25-17(26)11-7-8-12-18(27)31-3)22(30)24-16(20(28)21(23)29)13-15-9-5-4-6-10-15/h4-6,9-10,14,16,19H,7-8,11-13H2,1-3H3,(H2,23,29)(H,24,30)(H,25,26)/t16?,19-/m0/s1 |
| InChIKey | MKCBDMZLJJRKIS-CVMIBEPCSA-N |
| XLogP | 0.64 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|