C22H34N2O4 — CID 139697253
(2S)-2-[[(2S)-3-methyl-2-(octanoylamino)butanoyl]amino]-3-phenylpropanoic acid (PubChem CID 139697253) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-methyl-2-(octanoylamino)butanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-methyl-2-(octanoylamino)butanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 139697253 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | (2S)-2-[[(2S)-3-methyl-2-(octanoylamino)butanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCCCCCCC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C22H34N2O4/c1-4-5-6-7-11-14-19(25)24-20(16(2)3)21(26)23-18(22(27)28)15-17-12-9-8-10-13-17/h8-10,12-13,16,18,20H,4-7,11,14-15H2,1-3H3,(H,23,26)(H,24,25)(H,27,28)/t18-,20-/m0/s1 |
| InChIKey | RWHOYIGMJVFHBE-ICSRJNTNSA-N |
| XLogP | 3.30 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|