C23H36N2O6 — CID 66747921
methyl 8-[[(2S)-1-[[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate (PubChem CID 66747921) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is methyl 8-[[(2S)-1-[[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate.
| Compound Name | methyl 8-[[(2S)-1-[[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 66747921 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | methyl 8-[[(2S)-1-[[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)N[C@H](C(=O)NC(CO)Cc1ccc(O)cc1)C(C)C |
| InChI | InChI=1S/C23H36N2O6/c1-16(2)22(25-20(28)8-6-4-5-7-9-21(29)31-3)23(30)24-18(15-26)14-17-10-12-19(27)13-11-17/h10-13,16,18,22,26-27H,4-9,14-15H2,1-3H3,(H,24,30)(H,25,28)/t18?,22-/m0/s1 |
| InChIKey | LYWRKHWDSSZJIK-YSYXNDDBSA-N |
| XLogP | 2.07 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|