C29H41N3O6 — CID 54153330
benzyl (2S)-2-[[(2S)-3-(aminomethyl)-4-hydroxy-2-[6-(4-hydroxyphenyl)hexanoylamino]butanoyl]amino]-3-methylbutanoate (PubChem CID 54153330) has the molecular formula C29H41N3O6 and a molecular weight of 527.66 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-3-(aminomethyl)-4-hydroxy-2-[6-(4-hydroxyphenyl)hexanoylamino]butanoyl]amino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-3-(aminomethyl)-4-hydroxy-2-[6-(4-hydroxyphenyl)hexanoylamino]butanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 54153330 |
| Molecular Formula | C29H41N3O6 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-3-(aminomethyl)-4-hydroxy-2-[6-(4-hydroxyphenyl)hexanoylamino]butanoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)CCCCCc1ccc(O)cc1)C(CN)CO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H41N3O6/c1-20(2)26(29(37)38-19-22-10-6-3-7-11-22)32-28(36)27(23(17-30)18-33)31-25(35)12-8-4-5-9-21-13-15-24(34)16-14-21/h3,6-7,10-11,13-16,20,23,26-27,33-34H,4-5,8-9,12,17-19,30H2,1-2H3,(H,31,35)(H,32,36)/t23?,26-,27-/m0/s1 |
| InChIKey | OJHILSTYVSKEIK-ZROWWJAZSA-N |
| XLogP | 2.43 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|