C20H22BrNO3 — CID 8848053
(4-bromophenyl)methyl (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 8848053) has the molecular formula C20H22BrNO3 and a molecular weight of 404.30 g/mol. Its IUPAC name is (4-bromophenyl)methyl (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | (4-bromophenyl)methyl (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 8848053 |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (4-bromophenyl)methyl (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrNO3/c1-14(2)19(22-18(23)12-15-6-4-3-5-7-15)20(24)25-13-16-8-10-17(21)11-9-16/h3-11,14,19H,12-13H2,1-2H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | ORPWLPVKMQQUJX-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |