C19H21BrN2O3 — CID 7617139
(4-bromophenyl)methyl (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617139) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is (4-bromophenyl)methyl (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | (4-bromophenyl)methyl (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617139 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | (4-bromophenyl)methyl (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrN2O3/c1-13(2)17(22-19(24)21-16-6-4-3-5-7-16)18(23)25-12-14-8-10-15(20)11-9-14/h3-11,13,17H,12H2,1-2H3,(H2,21,22,24)/t17-/m1/s1 |
| InChIKey | UZGXZLIHWRSEDX-QGZVFWFLSA-N |
| XLogP | 4.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |