C23H29N3O4 — CID 7616772
[(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7616772) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7616772 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CCc1ccc(NC(=O)[C@H](C)OC(=O)[C@@H](NC(=O)Nc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-5-17-11-13-19(14-12-17)24-21(27)16(4)30-22(28)20(15(2)3)26-23(29)25-18-9-7-6-8-10-18/h6-16,20H,5H2,1-4H3,(H,24,27)(H2,25,26,29)/t16-,20-/m0/s1 |
| InChIKey | FVKCOALANLYOTM-JXFKEZNVSA-N |
| XLogP | 3.97 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |