C18H27N3O5 — CID 8981710
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 8981710) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 8981710 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)[C@H](NC(=O)Nc1ccccc1)C(C)C |
| InChI | InChI=1S/C18H27N3O5/c1-12(2)15(21-18(24)20-14-8-6-5-7-9-14)17(23)26-13(3)16(22)19-10-11-25-4/h5-9,12-13,15H,10-11H2,1-4H3,(H,19,22)(H2,20,21,24)/t13-,15+/m0/s1 |
| InChIKey | AQPUOJNRFMKCBS-DZGCQCFKSA-N |
| XLogP | 1.53 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|