C22H24N4O4 — CID 7616983
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7616983) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7616983 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)O[C@@H](C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H24N4O4/c1-14(2)19(26-22(29)25-17-9-5-4-6-10-17)21(28)30-15(3)20(27)24-18-11-7-8-16(12-18)13-23/h4-12,14-15,19H,1-3H3,(H,24,27)(H2,25,26,29)/t15-,19+/m0/s1 |
| InChIKey | UFJXKCPZXQDVED-HNAYVOBHSA-N |
| XLogP | 3.27 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |