C17H25NO3 — CID 165166794
benzyl (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutanoate (PubChem CID 165166794) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is benzyl (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 165166794 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | benzyl (2S)-2-(2,2-dimethylpropanoylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-12(2)14(18-16(20)17(3,4)5)15(19)21-11-13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | SULVILBMBBQCOV-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |