C22H33NO6 — CID 14379046
(3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 14379046) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 14379046 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)OC(C(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C22H33NO6/c1-14(2)17(23-21(26)29-22(5,6)7)19(24)28-18(15(3)4)20(25)27-13-16-11-9-8-10-12-16/h8-12,14-15,17-18H,13H2,1-7H3,(H,23,26) |
| InChIKey | ISOXEDCIBRNRBP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|