C20H29NO5 — CID 59680880
benzyl (4S)-2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate (PubChem CID 59680880) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is benzyl (4S)-2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate.
| Compound Name | benzyl (4S)-2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate |
|---|---|
| PubChem CID | 59680880 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | benzyl (4S)-2,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanoate |
| SMILES | CC(C(=O)OCc1ccccc1)C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H29NO5/c1-13(2)16(21-19(24)26-20(4,5)6)17(22)14(3)18(23)25-12-15-10-8-7-9-11-15/h7-11,13-14,16H,12H2,1-6H3,(H,21,24)/t14?,16-/m0/s1 |
| InChIKey | IZAQIYXNCRFOHO-WMCAAGNKSA-N |
| XLogP | 3.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|