C26H34N2O4S — CID 10863659
benzyl (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanethioyl]amino]butanoate (PubChem CID 10863659) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanethioyl]amino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanethioyl]amino]butanoate |
|---|---|
| PubChem CID | 10863659 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanethioyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=S)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O4S/c1-18(2)22(24(29)31-17-20-14-10-7-11-15-20)28-23(33)21(16-19-12-8-6-9-13-19)27-25(30)32-26(3,4)5/h6-15,18,21-22H,16-17H2,1-5H3,(H,27,30)(H,28,33)/t21-,22+/m1/s1 |
| InChIKey | PERIFXHTSVSIOP-YADHBBJMSA-N |
| XLogP | 4.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|