C28H36N2O6 — CID 11071082
benzyl (2S)-4-methyl-2-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutanoyl]amino]pentanoate (PubChem CID 11071082) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is benzyl (2S)-4-methyl-2-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutanoyl]amino]pentanoate.
| Compound Name | benzyl (2S)-4-methyl-2-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 11071082 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | benzyl (2S)-4-methyl-2-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutanoyl]amino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C(=O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H36N2O6/c1-19(2)16-23(26(33)35-18-21-14-10-7-11-15-21)29-25(32)24(31)22(17-20-12-8-6-9-13-20)30-27(34)36-28(3,4)5/h6-15,19,22-23H,16-18H2,1-5H3,(H,29,32)(H,30,34)/t22-,23+/m1/s1 |
| InChIKey | RTHNOANIQALQQH-PKTZIBPZSA-N |
| XLogP | 3.97 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|