C19H27NO5 — CID 21219327
tert-butyl 5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 21219327) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is tert-butyl 5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl 5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 21219327 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | tert-butyl 5-methyl-3-oxo-4-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO5/c1-13(2)17(15(21)11-16(22)25-19(3,4)5)20-18(23)24-12-14-9-7-6-8-10-14/h6-10,13,17H,11-12H2,1-5H3,(H,20,23) |
| InChIKey | FGKFTCDIARXOCS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|