C23H33NO5 — CID 170598552
tert-butyl (4S)-4-cycloheptyl-3-oxo-4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 170598552) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl (4S)-4-cycloheptyl-3-oxo-4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (4S)-4-cycloheptyl-3-oxo-4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 170598552 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | tert-butyl (4S)-4-cycloheptyl-3-oxo-4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)[C@@H](NC(=O)OCc1ccccc1)C1CCCCCC1 |
| InChI | InChI=1S/C23H33NO5/c1-23(2,3)29-20(26)15-19(25)21(18-13-9-4-5-10-14-18)24-22(27)28-16-17-11-7-6-8-12-17/h6-8,11-12,18,21H,4-5,9-10,13-16H2,1-3H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | KLXGSRDFHQQYKI-NRFANRHFSA-N |
| XLogP | 4.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|