C27H39N3O5 — CID 143960726
benzyl (3aR,6aR)-1-[2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 143960726) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is benzyl (3aR,6aR)-1-[2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aR,6aR)-1-[2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 143960726 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | benzyl (3aR,6aR)-1-[2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1CC[C@@H]2[C@H]1CCN2C(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H39N3O5/c1-27(2,3)35-25(32)28-23(20-12-8-5-9-13-20)24(31)29-16-14-22-21(29)15-17-30(22)26(33)34-18-19-10-6-4-7-11-19/h4,6-7,10-11,20-23H,5,8-9,12-18H2,1-3H3,(H,28,32)/t21-,22-,23?/m1/s1 |
| InChIKey | GPZTTZRCOGDUEE-WELAQSEPSA-N |
| XLogP | 4.47 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |