C16H23NO5 — CID 54562701
tert-butyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 54562701) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 54562701 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | C[C@H](O)[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO5/c1-11(18)13(14(19)22-16(2,3)4)17-15(20)21-10-12-8-6-5-7-9-12/h5-9,11,13,18H,10H2,1-4H3,(H,17,20)/t11-,13-/m0/s1 |
| InChIKey | ZRQUTSHDNGTITM-AAEUAGOBSA-N |
| XLogP | 2.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |