C18H25NO7 — CID 139931595
(2-carboxyoxy-2-methylpropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 139931595) has the molecular formula C18H25NO7 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2-carboxyoxy-2-methylpropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (2-carboxyoxy-2-methylpropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 139931595 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2-carboxyoxy-2-methylpropyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCC(C)(C)OC(=O)O |
| InChI | InChI=1S/C18H25NO7/c1-12(2)14(15(20)25-11-18(3,4)26-17(22)23)19-16(21)24-10-13-8-6-5-7-9-13/h5-9,12,14H,10-11H2,1-4H3,(H,19,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | JZCIKFGNBINUKI-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|