C15H23ClN2O4 — CID 129218181
2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyethylazanium chloride (PubChem CID 129218181) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyethylazanium chloride.
| Compound Name | 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyethylazanium chloride |
|---|---|
| PubChem CID | 129218181 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyethylazanium chloride |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCC[NH3+].[Cl-] |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-11(2)13(14(18)20-9-8-16)17-15(19)21-10-12-6-4-3-5-7-12;/h3-7,11,13H,8-10,16H2,1-2H3,(H,17,19);1H/t13-;/m0./s1 |
| InChIKey | ZILIVZXUBCKCLA-ZOWNYOTGSA-N |
| XLogP | -2.27 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |