C19H16Cl5NO4 — CID 22790965
(2,3,4,5,6-pentachlorophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 22790965) has the molecular formula C19H16Cl5NO4 and a molecular weight of 499.61 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 22790965 |
| Molecular Formula | C19H16Cl5NO4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C19H16Cl5NO4/c1-9(2)16(25-19(27)28-8-10-6-4-3-5-7-10)18(26)29-17-14(23)12(21)11(20)13(22)15(17)24/h3-7,9,16H,8H2,1-2H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | BQNDXRZFPNDYRN-INIZCTEOSA-N |
| XLogP | 6.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|