C33H36N2O10 — CID 54061191
2,3-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]benzoic acid (PubChem CID 54061191) has the molecular formula C33H36N2O10 and a molecular weight of 620.66 g/mol. Its IUPAC name is 2,3-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]benzoic acid.
| Compound Name | 2,3-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]benzoic acid |
|---|---|
| PubChem CID | 54061191 |
| Molecular Formula | C33H36N2O10 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 2,3-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]benzoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1cccc(C(=O)O)c1OC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C33H36N2O10/c1-20(2)26(34-32(40)42-18-22-12-7-5-8-13-22)30(38)44-25-17-11-16-24(29(36)37)28(25)45-31(39)27(21(3)4)35-33(41)43-19-23-14-9-6-10-15-23/h5-17,20-21,26-27H,18-19H2,1-4H3,(H,34,40)(H,35,41)(H,36,37)/t26-,27-/m0/s1 |
| InChIKey | LZUVJNNNRUFJQE-SVBPBHIXSA-N |
| XLogP | 5.10 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|