C21H23NO5 — CID 3882664
phenacyl 3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 3882664) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is phenacyl 3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | phenacyl 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 3882664 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | phenacyl 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO5/c1-15(2)19(22-21(25)27-13-16-9-5-3-6-10-16)20(24)26-14-18(23)17-11-7-4-8-12-17/h3-12,15,19H,13-14H2,1-2H3,(H,22,25) |
| InChIKey | TXYGOOBWNJAWSR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |