C22H24ClNO5 — CID 3355759
[2-(3-chlorophenyl)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 3355759) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | [2-(3-chlorophenyl)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 3355759 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [2-(3-chlorophenyl)-2-oxoethyl] 3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)OCC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClNO5/c1-3-15(2)20(24-22(27)29-13-16-8-5-4-6-9-16)21(26)28-14-19(25)17-10-7-11-18(23)12-17/h4-12,15,20H,3,13-14H2,1-2H3,(H,24,27) |
| InChIKey | NCSLODLIKVBTJY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |