C15H18F3NO3 — CID 57158753
benzyl N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 57158753) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is benzyl N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 57158753 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | benzyl N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | CCC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO3/c1-3-10(2)12(13(20)15(16,17)18)19-14(21)22-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,19,21)/t10?,12-/m0/s1 |
| InChIKey | QBSIECRELKWOKJ-KFJBMODSSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |