C14H16F3NO4 — CID 11716716
(2S,3R)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoic acid (PubChem CID 11716716) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is (2S,3R)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoic acid.
| Compound Name | (2S,3R)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 11716716 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S,3R)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)pentanoic acid |
| SMILES | CC[C@H]([C@H](NC(=O)OCc1ccccc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO4/c1-2-10(14(15,16)17)11(12(19)20)18-13(21)22-8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3,(H,18,21)(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | IQSMVDOUXUCYIN-MNOVXSKESA-N |
| XLogP | 2.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |