C13H15F2NO4 — CID 101131913
ethyl (2S)-3,3-difluoro-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 101131913) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is ethyl (2S)-3,3-difluoro-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl (2S)-3,3-difluoro-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 101131913 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | ethyl (2S)-3,3-difluoro-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)OCc1ccccc1)C(F)F |
| InChI | InChI=1S/C13H15F2NO4/c1-2-19-12(17)10(11(14)15)16-13(18)20-8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3,(H,16,18)/t10-/m1/s1 |
| InChIKey | PELRBOWQKPHMMD-SNVBAGLBSA-N |
| XLogP | 2.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |