C13H17NO4S — CID 7068918
ethyl (2R)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate (PubChem CID 7068918) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is ethyl (2R)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 7068918 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | ethyl (2R)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4S/c1-2-17-12(15)11(9-19)14-13(16)18-8-10-6-4-3-5-7-10/h3-7,11,19H,2,8-9H2,1H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | IWZJZGRUIZUKJJ-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|