C15H20N2O6S — CID 175774045
methyl (2R)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-sulfanylpropanoate (PubChem CID 175774045) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-sulfanylpropanoate.
| Compound Name | methyl (2R)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 175774045 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | methyl (2R)-2-[[(2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)[C@H](CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O6S/c1-22-14(20)12(9-24)16-13(19)11(7-18)17-15(21)23-8-10-5-3-2-4-6-10/h2-6,11-12,18,24H,7-9H2,1H3,(H,16,19)(H,17,21)/t11-,12-/m0/s1 |
| InChIKey | BMYCYKJBZLQUNL-RYUDHWBXSA-N |
| XLogP | -0.14 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|