C14H20N4O6 — CID 165355789
benzyl N-[1-[(1-hydrazinyl-3-hydroxy-1-oxopropan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 165355789) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is benzyl N-[1-[(1-hydrazinyl-3-hydroxy-1-oxopropan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(1-hydrazinyl-3-hydroxy-1-oxopropan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 165355789 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | benzyl N-[1-[(1-hydrazinyl-3-hydroxy-1-oxopropan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | NNC(=O)C(CO)NC(=O)C(CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H20N4O6/c15-18-13(22)11(7-20)16-12(21)10(6-19)17-14(23)24-8-9-4-2-1-3-5-9/h1-5,10-11,19-20H,6-8,15H2,(H,16,21)(H,17,23)(H,18,22) |
| InChIKey | ZLRBUUVGFYLZQK-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|