C18H21N3O3S — CID 90470498
benzyl N-[(2R)-3-benzylsulfanyl-1-hydrazinyl-1-oxopropan-2-yl]carbamate (PubChem CID 90470498) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is benzyl N-[(2R)-3-benzylsulfanyl-1-hydrazinyl-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-3-benzylsulfanyl-1-hydrazinyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90470498 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | benzyl N-[(2R)-3-benzylsulfanyl-1-hydrazinyl-1-oxopropan-2-yl]carbamate |
| SMILES | NNC(=O)[C@H](CSCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21N3O3S/c19-21-17(22)16(13-25-12-15-9-5-2-6-10-15)20-18(23)24-11-14-7-3-1-4-8-14/h1-10,16H,11-13,19H2,(H,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | ZABPBCXJNXYEJD-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|