C24H30N4O6S2 — CID 10840040
benzyl N-[(2R)-1-(methylamino)-3-[[(2R)-3-(methylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate (PubChem CID 10840040) has the molecular formula C24H30N4O6S2 and a molecular weight of 534.66 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(methylamino)-3-[[(2R)-3-(methylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(methylamino)-3-[[(2R)-3-(methylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10840040 |
| Molecular Formula | C24H30N4O6S2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | benzyl N-[(2R)-1-(methylamino)-3-[[(2R)-3-(methylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CNC(=O)[C@H](CSSC[C@H](NC(=O)OCc1ccccc1)C(=O)NC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N4O6S2/c1-25-21(29)19(27-23(31)33-13-17-9-5-3-6-10-17)15-35-36-16-20(22(30)26-2)28-24(32)34-14-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32)/t19-,20-/m0/s1 |
| InChIKey | JEBYKMDJCGEJQE-PMACEKPBSA-N |
| XLogP | 2.45 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|