C44H42N8O6S2 — CID 54516732
benzyl N-[1-(dipyridin-4-ylmethylamino)-3-[[(2R)-3-(dipyridin-4-ylmethylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate (PubChem CID 54516732) has the molecular formula C44H42N8O6S2 and a molecular weight of 843.00 g/mol. Its IUPAC name is benzyl N-[1-(dipyridin-4-ylmethylamino)-3-[[(2R)-3-(dipyridin-4-ylmethylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(dipyridin-4-ylmethylamino)-3-[[(2R)-3-(dipyridin-4-ylmethylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54516732 |
| Molecular Formula | C44H42N8O6S2 |
| Molecular Weight | 843.00 g/mol |
| Exact Mass | 842.27 |
| IUPAC Name | benzyl N-[1-(dipyridin-4-ylmethylamino)-3-[[(2R)-3-(dipyridin-4-ylmethylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]disulfanyl]-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(NC(CSSC[C@H](NC(=O)OCc1ccccc1)C(=O)NC(c1ccncc1)c1ccncc1)C(=O)NC(c1ccncc1)c1ccncc1)OCc1ccccc1 |
| InChI | InChI=1S/C44H42N8O6S2/c53-41(51-39(33-11-19-45-20-12-33)34-13-21-46-22-14-34)37(49-43(55)57-27-31-7-3-1-4-8-31)29-59-60-30-38(50-44(56)58-28-32-9-5-2-6-10-32)42(54)52-40(35-15-23-47-24-16-35)36-17-25-48-26-18-36/h1-26,37-40H,27-30H2,(H,49,55)(H,50,56)(H,51,53)(H,52,54)/t37-,38?/m0/s1 |
| InChIKey | YMXXDOXOISRWIH-AIQPRDSRSA-N |
| XLogP | 6.35 |
| TPSA | 186.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.00 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|