C30H40N2O8S2 — CID 177297165
benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate (PubChem CID 177297165) has the molecular formula C30H40N2O8S2 and a molecular weight of 620.79 g/mol. Its IUPAC name is benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate.
| Compound Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 177297165 |
| Molecular Formula | C30H40N2O8S2 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSSC[C@@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H40N2O8S2/c1-29(2,3)39-27(35)31-23(25(33)37-17-21-13-9-7-10-14-21)19-41-42-20-24(32-28(36)40-30(4,5)6)26(34)38-18-22-15-11-8-12-16-22/h7-16,23-24H,17-20H2,1-6H3,(H,31,35)(H,32,36)/t23-,24-/m1/s1 |
| InChIKey | HUFSGPVKFJJRKV-DNQXCXABSA-N |
| XLogP | 5.64 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|