C19H22N2O4 — CID 90470317
pyridin-4-ylmethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 90470317) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is pyridin-4-ylmethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | pyridin-4-ylmethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 90470317 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | pyridin-4-ylmethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccncc1 |
| InChI | InChI=1S/C19H22N2O4/c1-14(2)17(18(22)24-12-16-8-10-20-11-9-16)21-19(23)25-13-15-6-4-3-5-7-15/h3-11,14,17H,12-13H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | PYJYEGRNQFUDJL-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |