C24H25N3O3 — CID 44765105
benzyl N-[4-oxo-4-[[phenyl(pyridin-4-yl)methyl]amino]butyl]carbamate (PubChem CID 44765105) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[[phenyl(pyridin-4-yl)methyl]amino]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[[phenyl(pyridin-4-yl)methyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 44765105 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | benzyl N-[4-oxo-4-[[phenyl(pyridin-4-yl)methyl]amino]butyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)NC(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C24H25N3O3/c28-22(12-7-15-26-24(29)30-18-19-8-3-1-4-9-19)27-23(20-10-5-2-6-11-20)21-13-16-25-17-14-21/h1-6,8-11,13-14,16-17,23H,7,12,15,18H2,(H,26,29)(H,27,28) |
| InChIKey | YWGNCEKLAGXWKU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|