C27H29N3O4 — CID 55837379
benzyl N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]carbamate (PubChem CID 55837379) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is benzyl N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55837379 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | benzyl N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]carbamate |
| SMILES | CC(NC(=O)CCCNC(=O)OCc1ccccc1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H29N3O4/c1-20(23-14-8-15-24(18-23)30-26(32)22-12-6-3-7-13-22)29-25(31)16-9-17-28-27(33)34-19-21-10-4-2-5-11-21/h2-8,10-15,18,20H,9,16-17,19H2,1H3,(H,28,33)(H,29,31)(H,30,32) |
| InChIKey | GCXRXHFPBOQZEO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|