C26H26ClN3O3 — CID 46464874
N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]-4-chlorobenzamide (PubChem CID 46464874) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]-4-chlorobenzamide.
| Compound Name | N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 46464874 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[4-[1-(3-benzamidophenyl)ethylamino]-4-oxobutyl]-4-chlorobenzamide |
| SMILES | CC(NC(=O)CCCNC(=O)c1ccc(Cl)cc1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H26ClN3O3/c1-18(21-9-5-10-23(17-21)30-26(33)19-7-3-2-4-8-19)29-24(31)11-6-16-28-25(32)20-12-14-22(27)15-13-20/h2-5,7-10,12-15,17-18H,6,11,16H2,1H3,(H,28,32)(H,29,31)(H,30,33) |
| InChIKey | LWNPENUYYGZPOW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|