C24H22ClN3O3 — CID 46456768
N-[2-[1-(3-benzamidophenyl)ethylamino]-2-oxoethyl]-2-chlorobenzamide (PubChem CID 46456768) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is N-[2-[1-(3-benzamidophenyl)ethylamino]-2-oxoethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[1-(3-benzamidophenyl)ethylamino]-2-oxoethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 46456768 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[2-[1-(3-benzamidophenyl)ethylamino]-2-oxoethyl]-2-chlorobenzamide |
| SMILES | CC(NC(=O)CNC(=O)c1ccccc1Cl)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-16(27-22(29)15-26-24(31)20-12-5-6-13-21(20)25)18-10-7-11-19(14-18)28-23(30)17-8-3-2-4-9-17/h2-14,16H,15H2,1H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | ZUENQHAUQUXMLO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |